C13H8F2N2O4 — CID 81439837
4,5-difluoro-2-[(3-hydroxypyridine-4-carbonyl)amino]benzoic acid (PubChem CID 81439837) has the molecular formula C13H8F2N2O4 and a molecular weight of 294.21 g/mol. Its IUPAC name is 4,5-difluoro-2-[(3-hydroxypyridine-4-carbonyl)amino]benzoic acid.
| Compound Name | 4,5-difluoro-2-[(3-hydroxypyridine-4-carbonyl)amino]benzoic acid |
|---|---|
| PubChem CID | 81439837 |
| Molecular Formula | C13H8F2N2O4 |
| Molecular Weight | 294.21 g/mol |
| Exact Mass | 294.05 |
| IUPAC Name | 4,5-difluoro-2-[(3-hydroxypyridine-4-carbonyl)amino]benzoic acid |
| SMILES | O=C(Nc1cc(F)c(F)cc1C(=O)O)c1ccncc1O |
| InChI | InChI=1S/C13H8F2N2O4/c14-8-3-7(13(20)21)10(4-9(8)15)17-12(19)6-1-2-16-5-11(6)18/h1-5,18H,(H,17,19)(H,20,21) |
| InChIKey | OJVQYROZYVKZDN-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.21 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |