C12H8Cl2N4O3 — CID 107589400
3,5-dichloro-2-(pyrimidin-5-ylcarbamoylamino)benzoic acid (PubChem CID 107589400) has the molecular formula C12H8Cl2N4O3 and a molecular weight of 327.13 g/mol. Its IUPAC name is 3,5-dichloro-2-(pyrimidin-5-ylcarbamoylamino)benzoic acid.
| Compound Name | 3,5-dichloro-2-(pyrimidin-5-ylcarbamoylamino)benzoic acid |
|---|---|
| PubChem CID | 107589400 |
| Molecular Formula | C12H8Cl2N4O3 |
| Molecular Weight | 327.13 g/mol |
| Exact Mass | 326.00 |
| IUPAC Name | 3,5-dichloro-2-(pyrimidin-5-ylcarbamoylamino)benzoic acid |
| SMILES | O=C(Nc1cncnc1)Nc1c(Cl)cc(Cl)cc1C(=O)O |
| InChI | InChI=1S/C12H8Cl2N4O3/c13-6-1-8(11(19)20)10(9(14)2-6)18-12(21)17-7-3-15-5-16-4-7/h1-5H,(H,19,20)(H2,17,18,21) |
| InChIKey | NZMDYVUGIABFMW-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 104.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.13 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |