C10H6Cl2N4O3S — CID 114913171
3,5-dichloro-2-(thiadiazol-5-ylcarbamoylamino)benzoic acid (PubChem CID 114913171) has the molecular formula C10H6Cl2N4O3S and a molecular weight of 333.16 g/mol. Its IUPAC name is 3,5-dichloro-2-(thiadiazol-5-ylcarbamoylamino)benzoic acid.
| Compound Name | 3,5-dichloro-2-(thiadiazol-5-ylcarbamoylamino)benzoic acid |
|---|---|
| PubChem CID | 114913171 |
| Molecular Formula | C10H6Cl2N4O3S |
| Molecular Weight | 333.16 g/mol |
| Exact Mass | 331.95 |
| IUPAC Name | 3,5-dichloro-2-(thiadiazol-5-ylcarbamoylamino)benzoic acid |
| SMILES | O=C(Nc1cnns1)Nc1c(Cl)cc(Cl)cc1C(=O)O |
| InChI | InChI=1S/C10H6Cl2N4O3S/c11-4-1-5(9(17)18)8(6(12)2-4)15-10(19)14-7-3-13-16-20-7/h1-3H,(H,17,18)(H2,14,15,19) |
| InChIKey | YRNONTGSWYEBCJ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 104.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.16 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |