C11H7Cl2N3O3S — CID 43331475
3,5-dichloro-2-[(4-methylthiadiazole-5-carbonyl)amino]benzoic acid (PubChem CID 43331475) has the molecular formula C11H7Cl2N3O3S and a molecular weight of 332.17 g/mol. Its IUPAC name is 3,5-dichloro-2-[(4-methylthiadiazole-5-carbonyl)amino]benzoic acid.
| Compound Name | 3,5-dichloro-2-[(4-methylthiadiazole-5-carbonyl)amino]benzoic acid |
|---|---|
| PubChem CID | 43331475 |
| Molecular Formula | C11H7Cl2N3O3S |
| Molecular Weight | 332.17 g/mol |
| Exact Mass | 330.96 |
| IUPAC Name | 3,5-dichloro-2-[(4-methylthiadiazole-5-carbonyl)amino]benzoic acid |
| SMILES | Cc1nnsc1C(=O)Nc1c(Cl)cc(Cl)cc1C(=O)O |
| InChI | InChI=1S/C11H7Cl2N3O3S/c1-4-9(20-16-15-4)10(17)14-8-6(11(18)19)2-5(12)3-7(8)13/h2-3H,1H3,(H,14,17)(H,18,19) |
| InChIKey | WYOQNJNSNSGIHG-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.17 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |