C10H7Cl2N3OS — CID 7293435
N-(3,4-dichlorophenyl)-4-methylthiadiazole-5-carboxamide (PubChem CID 7293435) has the molecular formula C10H7Cl2N3OS and a molecular weight of 288.16 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-4-methylthiadiazole-5-carboxamide.
| Compound Name | N-(3,4-dichlorophenyl)-4-methylthiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 7293435 |
| Molecular Formula | C10H7Cl2N3OS |
| Molecular Weight | 288.16 g/mol |
| Exact Mass | 286.97 |
| IUPAC Name | N-(3,4-dichlorophenyl)-4-methylthiadiazole-5-carboxamide |
| SMILES | Cc1nnsc1C(=O)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C10H7Cl2N3OS/c1-5-9(17-15-14-5)10(16)13-6-2-3-7(11)8(12)4-6/h2-4H,1H3,(H,13,16) |
| InChIKey | WCYMCGFMRGJWBX-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.16 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |