C10H9BrN4OS — CID 82862458
N-(4-amino-3-bromophenyl)-4-methylthiadiazole-5-carboxamide (PubChem CID 82862458) has the molecular formula C10H9BrN4OS and a molecular weight of 313.18 g/mol. Its IUPAC name is N-(4-amino-3-bromophenyl)-4-methylthiadiazole-5-carboxamide.
| Compound Name | N-(4-amino-3-bromophenyl)-4-methylthiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 82862458 |
| Molecular Formula | C10H9BrN4OS |
| Molecular Weight | 313.18 g/mol |
| Exact Mass | 311.97 |
| IUPAC Name | N-(4-amino-3-bromophenyl)-4-methylthiadiazole-5-carboxamide |
| SMILES | Cc1nnsc1C(=O)Nc1ccc(N)c(Br)c1 |
| InChI | InChI=1S/C10H9BrN4OS/c1-5-9(17-15-14-5)10(16)13-6-2-3-8(12)7(11)4-6/h2-4H,12H2,1H3,(H,13,16) |
| InChIKey | VGTBCDBOBLXPLZ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.18 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|