C11H11N3O2S — CID 64792721
N-(3-hydroxy-4-methylphenyl)-4-methylthiadiazole-5-carboxamide (PubChem CID 64792721) has the molecular formula C11H11N3O2S and a molecular weight of 249.30 g/mol. Its IUPAC name is N-(3-hydroxy-4-methylphenyl)-4-methylthiadiazole-5-carboxamide.
| Compound Name | N-(3-hydroxy-4-methylphenyl)-4-methylthiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 64792721 |
| Molecular Formula | C11H11N3O2S |
| Molecular Weight | 249.30 g/mol |
| Exact Mass | 249.06 |
| IUPAC Name | N-(3-hydroxy-4-methylphenyl)-4-methylthiadiazole-5-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2snnc2C)cc1O |
| InChI | InChI=1S/C11H11N3O2S/c1-6-3-4-8(5-9(6)15)12-11(16)10-7(2)13-14-17-10/h3-5,15H,1-2H3,(H,12,16) |
| InChIKey | ONGVKZNGBODMID-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.30 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |