C12H11N3O3S — CID 65346450
2-[3-[(4-methylthiadiazole-5-carbonyl)amino]phenyl]acetic acid (PubChem CID 65346450) has the molecular formula C12H11N3O3S and a molecular weight of 277.31 g/mol. Its IUPAC name is 2-[3-[(4-methylthiadiazole-5-carbonyl)amino]phenyl]acetic acid.
| Compound Name | 2-[3-[(4-methylthiadiazole-5-carbonyl)amino]phenyl]acetic acid |
|---|---|
| PubChem CID | 65346450 |
| Molecular Formula | C12H11N3O3S |
| Molecular Weight | 277.31 g/mol |
| Exact Mass | 277.05 |
| IUPAC Name | 2-[3-[(4-methylthiadiazole-5-carbonyl)amino]phenyl]acetic acid |
| SMILES | Cc1nnsc1C(=O)Nc1cccc(CC(=O)O)c1 |
| InChI | InChI=1S/C12H11N3O3S/c1-7-11(19-15-14-7)12(18)13-9-4-2-3-8(5-9)6-10(16)17/h2-5H,6H2,1H3,(H,13,18)(H,16,17) |
| InChIKey | NYMBTFZXMODDNM-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.31 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |