C13H12N2O4 — CID 81456260
2-[3-[(4-methyl-1,3-oxazole-5-carbonyl)amino]phenyl]acetic acid (PubChem CID 81456260) has the molecular formula C13H12N2O4 and a molecular weight of 260.25 g/mol. Its IUPAC name is 2-[3-[(4-methyl-1,3-oxazole-5-carbonyl)amino]phenyl]acetic acid.
| Compound Name | 2-[3-[(4-methyl-1,3-oxazole-5-carbonyl)amino]phenyl]acetic acid |
|---|---|
| PubChem CID | 81456260 |
| Molecular Formula | C13H12N2O4 |
| Molecular Weight | 260.25 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | 2-[3-[(4-methyl-1,3-oxazole-5-carbonyl)amino]phenyl]acetic acid |
| SMILES | Cc1ncoc1C(=O)Nc1cccc(CC(=O)O)c1 |
| InChI | InChI=1S/C13H12N2O4/c1-8-12(19-7-14-8)13(18)15-10-4-2-3-9(5-10)6-11(16)17/h2-5,7H,6H2,1H3,(H,15,18)(H,16,17) |
| InChIKey | JIFVFNRBOPOXRT-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 92.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.25 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |