C17H19NO4 — CID 119352015
2-[3-[(4,5-diethylfuran-2-carbonyl)amino]phenyl]acetic acid (PubChem CID 119352015) has the molecular formula C17H19NO4 and a molecular weight of 301.34 g/mol. Its IUPAC name is 2-[3-[(4,5-diethylfuran-2-carbonyl)amino]phenyl]acetic acid.
| Compound Name | 2-[3-[(4,5-diethylfuran-2-carbonyl)amino]phenyl]acetic acid |
|---|---|
| PubChem CID | 119352015 |
| Molecular Formula | C17H19NO4 |
| Molecular Weight | 301.34 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | 2-[3-[(4,5-diethylfuran-2-carbonyl)amino]phenyl]acetic acid |
| SMILES | CCc1cc(C(=O)Nc2cccc(CC(=O)O)c2)oc1CC |
| InChI | InChI=1S/C17H19NO4/c1-3-12-10-15(22-14(12)4-2)17(21)18-13-7-5-6-11(8-13)9-16(19)20/h5-8,10H,3-4,9H2,1-2H3,(H,18,21)(H,19,20) |
| InChIKey | ASFDWBUYSMLPFS-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.34 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |