C18H21N3O5 — CID 120822057
5-[[3-(dimethylcarbamoylamino)phenyl]methylcarbamoyl]-2-ethylfuran-3-carboxylic acid (PubChem CID 120822057) has the molecular formula C18H21N3O5 and a molecular weight of 359.38 g/mol. Its IUPAC name is 5-[[3-(dimethylcarbamoylamino)phenyl]methylcarbamoyl]-2-ethylfuran-3-carboxylic acid.
| Compound Name | 5-[[3-(dimethylcarbamoylamino)phenyl]methylcarbamoyl]-2-ethylfuran-3-carboxylic acid |
|---|---|
| PubChem CID | 120822057 |
| Molecular Formula | C18H21N3O5 |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | 5-[[3-(dimethylcarbamoylamino)phenyl]methylcarbamoyl]-2-ethylfuran-3-carboxylic acid |
| SMILES | CCc1oc(C(=O)NCc2cccc(NC(=O)N(C)C)c2)cc1C(=O)O |
| InChI | InChI=1S/C18H21N3O5/c1-4-14-13(17(23)24)9-15(26-14)16(22)19-10-11-6-5-7-12(8-11)20-18(25)21(2)3/h5-9H,4,10H2,1-3H3,(H,19,22)(H,20,25)(H,23,24) |
| InChIKey | YVPITUPPOAKRDN-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 111.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |