C16H18N2O6S — CID 120822531
2-ethyl-5-[[4-(methanesulfonamido)phenyl]methylcarbamoyl]furan-3-carboxylic acid (PubChem CID 120822531) has the molecular formula C16H18N2O6S and a molecular weight of 366.40 g/mol. Its IUPAC name is 2-ethyl-5-[[4-(methanesulfonamido)phenyl]methylcarbamoyl]furan-3-carboxylic acid.
| Compound Name | 2-ethyl-5-[[4-(methanesulfonamido)phenyl]methylcarbamoyl]furan-3-carboxylic acid |
|---|---|
| PubChem CID | 120822531 |
| Molecular Formula | C16H18N2O6S |
| Molecular Weight | 366.40 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | 2-ethyl-5-[[4-(methanesulfonamido)phenyl]methylcarbamoyl]furan-3-carboxylic acid |
| SMILES | CCc1oc(C(=O)NCc2ccc(NS(C)(=O)=O)cc2)cc1C(=O)O |
| InChI | InChI=1S/C16H18N2O6S/c1-3-13-12(16(20)21)8-14(24-13)15(19)17-9-10-4-6-11(7-5-10)18-25(2,22)23/h4-8,18H,3,9H2,1-2H3,(H,17,19)(H,20,21) |
| InChIKey | AKOZXLPZYCQHAU-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 125.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.40 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |