C18H21NO5 — CID 120821000
5-[[4-(ethoxymethyl)phenyl]methylcarbamoyl]-2-ethylfuran-3-carboxylic acid (PubChem CID 120821000) has the molecular formula C18H21NO5 and a molecular weight of 331.37 g/mol. Its IUPAC name is 5-[[4-(ethoxymethyl)phenyl]methylcarbamoyl]-2-ethylfuran-3-carboxylic acid.
| Compound Name | 5-[[4-(ethoxymethyl)phenyl]methylcarbamoyl]-2-ethylfuran-3-carboxylic acid |
|---|---|
| PubChem CID | 120821000 |
| Molecular Formula | C18H21NO5 |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | 5-[[4-(ethoxymethyl)phenyl]methylcarbamoyl]-2-ethylfuran-3-carboxylic acid |
| SMILES | CCOCc1ccc(CNC(=O)c2cc(C(=O)O)c(CC)o2)cc1 |
| InChI | InChI=1S/C18H21NO5/c1-3-15-14(18(21)22)9-16(24-15)17(20)19-10-12-5-7-13(8-6-12)11-23-4-2/h5-9H,3-4,10-11H2,1-2H3,(H,19,20)(H,21,22) |
| InChIKey | ZOEQJZWGELTXRX-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 88.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |