C17H19NO5 — CID 120821415
2-ethyl-5-[(3-methoxy-4-methylphenyl)methylcarbamoyl]furan-3-carboxylic acid (PubChem CID 120821415) has the molecular formula C17H19NO5 and a molecular weight of 317.34 g/mol. Its IUPAC name is 2-ethyl-5-[(3-methoxy-4-methylphenyl)methylcarbamoyl]furan-3-carboxylic acid.
| Compound Name | 2-ethyl-5-[(3-methoxy-4-methylphenyl)methylcarbamoyl]furan-3-carboxylic acid |
|---|---|
| PubChem CID | 120821415 |
| Molecular Formula | C17H19NO5 |
| Molecular Weight | 317.34 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | 2-ethyl-5-[(3-methoxy-4-methylphenyl)methylcarbamoyl]furan-3-carboxylic acid |
| SMILES | CCc1oc(C(=O)NCc2ccc(C)c(OC)c2)cc1C(=O)O |
| InChI | InChI=1S/C17H19NO5/c1-4-13-12(17(20)21)8-15(23-13)16(19)18-9-11-6-5-10(2)14(7-11)22-3/h5-8H,4,9H2,1-3H3,(H,18,19)(H,20,21) |
| InChIKey | PWODDGNKHYFOCP-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 88.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.34 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |