C18H22N2O6S — CID 120822028
5-[[4-(butylsulfonylamino)phenyl]carbamoyl]-2-ethylfuran-3-carboxylic acid (PubChem CID 120822028) has the molecular formula C18H22N2O6S and a molecular weight of 394.45 g/mol. Its IUPAC name is 5-[[4-(butylsulfonylamino)phenyl]carbamoyl]-2-ethylfuran-3-carboxylic acid.
| Compound Name | 5-[[4-(butylsulfonylamino)phenyl]carbamoyl]-2-ethylfuran-3-carboxylic acid |
|---|---|
| PubChem CID | 120822028 |
| Molecular Formula | C18H22N2O6S |
| Molecular Weight | 394.45 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | 5-[[4-(butylsulfonylamino)phenyl]carbamoyl]-2-ethylfuran-3-carboxylic acid |
| SMILES | CCCCS(=O)(=O)Nc1ccc(NC(=O)c2cc(C(=O)O)c(CC)o2)cc1 |
| InChI | InChI=1S/C18H22N2O6S/c1-3-5-10-27(24,25)20-13-8-6-12(7-9-13)19-17(21)16-11-14(18(22)23)15(4-2)26-16/h6-9,11,20H,3-5,10H2,1-2H3,(H,19,21)(H,22,23) |
| InChIKey | SQVIYFKVBNPRRP-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 125.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.45 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |