C16H14F4N2O5 — CID 120822574
2-ethyl-5-[[6-(2,2,3,3-tetrafluoropropoxy)-3-pyridinyl]carbamoyl]furan-3-carboxylic acid (PubChem CID 120822574) has the molecular formula C16H14F4N2O5 and a molecular weight of 390.29 g/mol. Its IUPAC name is 2-ethyl-5-[[6-(2,2,3,3-tetrafluoropropoxy)-3-pyridinyl]carbamoyl]furan-3-carboxylic acid.
| Compound Name | 2-ethyl-5-[[6-(2,2,3,3-tetrafluoropropoxy)-3-pyridinyl]carbamoyl]furan-3-carboxylic acid |
|---|---|
| PubChem CID | 120822574 |
| Molecular Formula | C16H14F4N2O5 |
| Molecular Weight | 390.29 g/mol |
| Exact Mass | 390.08 |
| IUPAC Name | 2-ethyl-5-[[6-(2,2,3,3-tetrafluoropropoxy)-3-pyridinyl]carbamoyl]furan-3-carboxylic acid |
| SMILES | CCc1oc(C(=O)Nc2ccc(OCC(F)(F)C(F)F)nc2)cc1C(=O)O |
| InChI | InChI=1S/C16H14F4N2O5/c1-2-10-9(14(24)25)5-11(27-10)13(23)22-8-3-4-12(21-6-8)26-7-16(19,20)15(17)18/h3-6,15H,2,7H2,1H3,(H,22,23)(H,24,25) |
| InChIKey | VHEQSWJUMKVMRJ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 101.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.29 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|