C13H14F4N4O2 — CID 96531382
N-[(1S)-1-(5-methyl-1,3,4-oxadiazol-2-yl)ethyl]-6-(2,2,3,3-tetrafluoropropoxy)pyridin-3-amine (PubChem CID 96531382) has the molecular formula C13H14F4N4O2 and a molecular weight of 334.27 g/mol. Its IUPAC name is N-[(1S)-1-(5-methyl-1,3,4-oxadiazol-2-yl)ethyl]-6-(2,2,3,3-tetrafluoropropoxy)pyridin-3-amine.
| Compound Name | N-[(1S)-1-(5-methyl-1,3,4-oxadiazol-2-yl)ethyl]-6-(2,2,3,3-tetrafluoropropoxy)pyridin-3-amine |
|---|---|
| PubChem CID | 96531382 |
| Molecular Formula | C13H14F4N4O2 |
| Molecular Weight | 334.27 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | N-[(1S)-1-(5-methyl-1,3,4-oxadiazol-2-yl)ethyl]-6-(2,2,3,3-tetrafluoropropoxy)pyridin-3-amine |
| SMILES | Cc1nnc([C@H](C)Nc2ccc(OCC(F)(F)C(F)F)nc2)o1 |
| InChI | InChI=1S/C13H14F4N4O2/c1-7(11-21-20-8(2)23-11)19-9-3-4-10(18-5-9)22-6-13(16,17)12(14)15/h3-5,7,12,19H,6H2,1-2H3/t7-/m0/s1 |
| InChIKey | HBTAGZQNLDYMNS-ZETCQYMHSA-N |
| XLogP | 3.23 |
| TPSA | 73.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.27 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|