C13H15F4N3O5 — CID 122079511
2-hydroxy-2-methyl-3-[[6-(2,2,3,3-tetrafluoropropoxy)-3-pyridinyl]carbamoylamino]propanoic acid (PubChem CID 122079511) has the molecular formula C13H15F4N3O5 and a molecular weight of 369.27 g/mol. Its IUPAC name is 2-hydroxy-2-methyl-3-[[6-(2,2,3,3-tetrafluoropropoxy)-3-pyridinyl]carbamoylamino]propanoic acid.
| Compound Name | 2-hydroxy-2-methyl-3-[[6-(2,2,3,3-tetrafluoropropoxy)-3-pyridinyl]carbamoylamino]propanoic acid |
|---|---|
| PubChem CID | 122079511 |
| Molecular Formula | C13H15F4N3O5 |
| Molecular Weight | 369.27 g/mol |
| Exact Mass | 369.09 |
| IUPAC Name | 2-hydroxy-2-methyl-3-[[6-(2,2,3,3-tetrafluoropropoxy)-3-pyridinyl]carbamoylamino]propanoic acid |
| SMILES | CC(O)(CNC(=O)Nc1ccc(OCC(F)(F)C(F)F)nc1)C(=O)O |
| InChI | InChI=1S/C13H15F4N3O5/c1-12(24,10(21)22)5-19-11(23)20-7-2-3-8(18-4-7)25-6-13(16,17)9(14)15/h2-4,9,24H,5-6H2,1H3,(H,21,22)(H2,19,20,23) |
| InChIKey | ZOVBMCHXDWYMFU-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 120.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.27 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|