C11H11F4N3O3 — CID 106295042
2-[5-(2,2,3,3-tetrafluoropropylcarbamoylamino)-2-pyridinyl]acetic acid (PubChem CID 106295042) has the molecular formula C11H11F4N3O3 and a molecular weight of 309.22 g/mol. Its IUPAC name is 2-[5-(2,2,3,3-tetrafluoropropylcarbamoylamino)-2-pyridinyl]acetic acid.
| Compound Name | 2-[5-(2,2,3,3-tetrafluoropropylcarbamoylamino)-2-pyridinyl]acetic acid |
|---|---|
| PubChem CID | 106295042 |
| Molecular Formula | C11H11F4N3O3 |
| Molecular Weight | 309.22 g/mol |
| Exact Mass | 309.07 |
| IUPAC Name | 2-[5-(2,2,3,3-tetrafluoropropylcarbamoylamino)-2-pyridinyl]acetic acid |
| SMILES | O=C(O)Cc1ccc(NC(=O)NCC(F)(F)C(F)F)cn1 |
| InChI | InChI=1S/C11H11F4N3O3/c12-9(13)11(14,15)5-17-10(21)18-7-2-1-6(16-4-7)3-8(19)20/h1-2,4,9H,3,5H2,(H,19,20)(H2,17,18,21) |
| InChIKey | YPNAJAQEMHUULB-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.22 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|