C12H11F4N3O4 — CID 56801791
2-nitro-N-[6-(2,2,3,3-tetrafluoropropoxy)-3-pyridinyl]cyclopropane-1-carboxamide (PubChem CID 56801791) has the molecular formula C12H11F4N3O4 and a molecular weight of 337.23 g/mol. Its IUPAC name is 2-nitro-N-[6-(2,2,3,3-tetrafluoropropoxy)-3-pyridinyl]cyclopropane-1-carboxamide.
| Compound Name | 2-nitro-N-[6-(2,2,3,3-tetrafluoropropoxy)-3-pyridinyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 56801791 |
| Molecular Formula | C12H11F4N3O4 |
| Molecular Weight | 337.23 g/mol |
| Exact Mass | 337.07 |
| IUPAC Name | 2-nitro-N-[6-(2,2,3,3-tetrafluoropropoxy)-3-pyridinyl]cyclopropane-1-carboxamide |
| SMILES | O=C(Nc1ccc(OCC(F)(F)C(F)F)nc1)C1CC1[N+](=O)[O-] |
| InChI | InChI=1S/C12H11F4N3O4/c13-11(14)12(15,16)5-23-9-2-1-6(4-17-9)18-10(20)7-3-8(7)19(21)22/h1-2,4,7-8,11H,3,5H2,(H,18,20) |
| InChIKey | SIHTVTKJQLHARV-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 94.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.23 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|