C18H14F4N4O5 — CID 55780290
1-(4-fluoro-3-nitrophenyl)-5-oxo-N-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]pyrrolidine-3-carboxamide (PubChem CID 55780290) has the molecular formula C18H14F4N4O5 and a molecular weight of 442.33 g/mol. Its IUPAC name is 1-(4-fluoro-3-nitrophenyl)-5-oxo-N-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]pyrrolidine-3-carboxamide.
| Compound Name | 1-(4-fluoro-3-nitrophenyl)-5-oxo-N-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 55780290 |
| Molecular Formula | C18H14F4N4O5 |
| Molecular Weight | 442.33 g/mol |
| Exact Mass | 442.09 |
| IUPAC Name | 1-(4-fluoro-3-nitrophenyl)-5-oxo-N-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]pyrrolidine-3-carboxamide |
| SMILES | O=C(Nc1ccc(OCC(F)(F)F)nc1)C1CC(=O)N(c2ccc(F)c([N+](=O)[O-])c2)C1 |
| InChI | InChI=1S/C18H14F4N4O5/c19-13-3-2-12(6-14(13)26(29)30)25-8-10(5-16(25)27)17(28)24-11-1-4-15(23-7-11)31-9-18(20,21)22/h1-4,6-7,10H,5,8-9H2,(H,24,28) |
| InChIKey | QNCNHEWDZKVJKQ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 114.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.33 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|