C19H18FN3O6 — CID 46538978
N-(3,4-dimethoxyphenyl)-1-(4-fluoro-3-nitrophenyl)-5-oxopyrrolidine-3-carboxamide (PubChem CID 46538978) has the molecular formula C19H18FN3O6 and a molecular weight of 403.37 g/mol. Its IUPAC name is N-(3,4-dimethoxyphenyl)-1-(4-fluoro-3-nitrophenyl)-5-oxopyrrolidine-3-carboxamide.
| Compound Name | N-(3,4-dimethoxyphenyl)-1-(4-fluoro-3-nitrophenyl)-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 46538978 |
| Molecular Formula | C19H18FN3O6 |
| Molecular Weight | 403.37 g/mol |
| Exact Mass | 403.12 |
| IUPAC Name | N-(3,4-dimethoxyphenyl)-1-(4-fluoro-3-nitrophenyl)-5-oxopyrrolidine-3-carboxamide |
| SMILES | COc1ccc(NC(=O)C2CC(=O)N(c3ccc(F)c([N+](=O)[O-])c3)C2)cc1OC |
| InChI | InChI=1S/C19H18FN3O6/c1-28-16-6-3-12(8-17(16)29-2)21-19(25)11-7-18(24)22(10-11)13-4-5-14(20)15(9-13)23(26)27/h3-6,8-9,11H,7,10H2,1-2H3,(H,21,25) |
| InChIKey | XRBPPEYCWCCRKW-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 111.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.37 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|