C20H19FN4O6 — CID 43055957
1-(4-fluoro-3-nitrophenyl)-N-[3-[(2-methoxyacetyl)amino]phenyl]-5-oxopyrrolidine-3-carboxamide (PubChem CID 43055957) has the molecular formula C20H19FN4O6 and a molecular weight of 430.39 g/mol. Its IUPAC name is 1-(4-fluoro-3-nitrophenyl)-N-[3-[(2-methoxyacetyl)amino]phenyl]-5-oxopyrrolidine-3-carboxamide.
| Compound Name | 1-(4-fluoro-3-nitrophenyl)-N-[3-[(2-methoxyacetyl)amino]phenyl]-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 43055957 |
| Molecular Formula | C20H19FN4O6 |
| Molecular Weight | 430.39 g/mol |
| Exact Mass | 430.13 |
| IUPAC Name | 1-(4-fluoro-3-nitrophenyl)-N-[3-[(2-methoxyacetyl)amino]phenyl]-5-oxopyrrolidine-3-carboxamide |
| SMILES | COCC(=O)Nc1cccc(NC(=O)C2CC(=O)N(c3ccc(F)c([N+](=O)[O-])c3)C2)c1 |
| InChI | InChI=1S/C20H19FN4O6/c1-31-11-18(26)22-13-3-2-4-14(8-13)23-20(28)12-7-19(27)24(10-12)15-5-6-16(21)17(9-15)25(29)30/h2-6,8-9,12H,7,10-11H2,1H3,(H,22,26)(H,23,28) |
| InChIKey | GZTHIPNPMVIJAI-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 130.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.39 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|