C22H23FN4O6 — CID 55571397
N-ethyl-1-(4-fluoro-3-nitrophenyl)-N-[2-(3-methoxyanilino)-2-oxoethyl]-5-oxopyrrolidine-3-carboxamide (PubChem CID 55571397) has the molecular formula C22H23FN4O6 and a molecular weight of 458.45 g/mol. Its IUPAC name is N-ethyl-1-(4-fluoro-3-nitrophenyl)-N-[2-(3-methoxyanilino)-2-oxoethyl]-5-oxopyrrolidine-3-carboxamide.
| Compound Name | N-ethyl-1-(4-fluoro-3-nitrophenyl)-N-[2-(3-methoxyanilino)-2-oxoethyl]-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 55571397 |
| Molecular Formula | C22H23FN4O6 |
| Molecular Weight | 458.45 g/mol |
| Exact Mass | 458.16 |
| IUPAC Name | N-ethyl-1-(4-fluoro-3-nitrophenyl)-N-[2-(3-methoxyanilino)-2-oxoethyl]-5-oxopyrrolidine-3-carboxamide |
| SMILES | CCN(CC(=O)Nc1cccc(OC)c1)C(=O)C1CC(=O)N(c2ccc(F)c([N+](=O)[O-])c2)C1 |
| InChI | InChI=1S/C22H23FN4O6/c1-3-25(13-20(28)24-15-5-4-6-17(10-15)33-2)22(30)14-9-21(29)26(12-14)16-7-8-18(23)19(11-16)27(31)32/h4-8,10-11,14H,3,9,12-13H2,1-2H3,(H,24,28) |
| InChIKey | PUIARFINISEYOG-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 122.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.45 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|