C21H21FN4O6 — CID 55673289
N-[3-[2-(ethylamino)-2-oxoethoxy]phenyl]-1-(4-fluoro-3-nitrophenyl)-5-oxopyrrolidine-3-carboxamide (PubChem CID 55673289) has the molecular formula C21H21FN4O6 and a molecular weight of 444.42 g/mol. Its IUPAC name is N-[3-[2-(ethylamino)-2-oxoethoxy]phenyl]-1-(4-fluoro-3-nitrophenyl)-5-oxopyrrolidine-3-carboxamide.
| Compound Name | N-[3-[2-(ethylamino)-2-oxoethoxy]phenyl]-1-(4-fluoro-3-nitrophenyl)-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 55673289 |
| Molecular Formula | C21H21FN4O6 |
| Molecular Weight | 444.42 g/mol |
| Exact Mass | 444.14 |
| IUPAC Name | N-[3-[2-(ethylamino)-2-oxoethoxy]phenyl]-1-(4-fluoro-3-nitrophenyl)-5-oxopyrrolidine-3-carboxamide |
| SMILES | CCNC(=O)COc1cccc(NC(=O)C2CC(=O)N(c3ccc(F)c([N+](=O)[O-])c3)C2)c1 |
| InChI | InChI=1S/C21H21FN4O6/c1-2-23-19(27)12-32-16-5-3-4-14(9-16)24-21(29)13-8-20(28)25(11-13)15-6-7-17(22)18(10-15)26(30)31/h3-7,9-10,13H,2,8,11-12H2,1H3,(H,23,27)(H,24,29) |
| InChIKey | OHUOTDVJIYWGQK-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 130.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.42 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|