C18H13F4N3O4 — CID 46538902
1-(4-fluoro-3-nitrophenyl)-5-oxo-N-[4-(trifluoromethyl)phenyl]pyrrolidine-3-carboxamide (PubChem CID 46538902) has the molecular formula C18H13F4N3O4 and a molecular weight of 411.31 g/mol. Its IUPAC name is 1-(4-fluoro-3-nitrophenyl)-5-oxo-N-[4-(trifluoromethyl)phenyl]pyrrolidine-3-carboxamide.
| Compound Name | 1-(4-fluoro-3-nitrophenyl)-5-oxo-N-[4-(trifluoromethyl)phenyl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 46538902 |
| Molecular Formula | C18H13F4N3O4 |
| Molecular Weight | 411.31 g/mol |
| Exact Mass | 411.08 |
| IUPAC Name | 1-(4-fluoro-3-nitrophenyl)-5-oxo-N-[4-(trifluoromethyl)phenyl]pyrrolidine-3-carboxamide |
| SMILES | O=C(Nc1ccc(C(F)(F)F)cc1)C1CC(=O)N(c2ccc(F)c([N+](=O)[O-])c2)C1 |
| InChI | InChI=1S/C18H13F4N3O4/c19-14-6-5-13(8-15(14)25(28)29)24-9-10(7-16(24)26)17(27)23-12-3-1-11(2-4-12)18(20,21)22/h1-6,8,10H,7,9H2,(H,23,27) |
| InChIKey | IOBSXDUOXDXNQX-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.31 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|