C22H24FN5O5 — CID 55785851
N-[6-(2,6-dimethylmorpholin-4-yl)-3-pyridinyl]-1-(4-fluoro-3-nitrophenyl)-5-oxopyrrolidine-3-carboxamide (PubChem CID 55785851) has the molecular formula C22H24FN5O5 and a molecular weight of 457.46 g/mol. Its IUPAC name is N-[6-(2,6-dimethylmorpholin-4-yl)-3-pyridinyl]-1-(4-fluoro-3-nitrophenyl)-5-oxopyrrolidine-3-carboxamide.
| Compound Name | N-[6-(2,6-dimethylmorpholin-4-yl)-3-pyridinyl]-1-(4-fluoro-3-nitrophenyl)-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 55785851 |
| Molecular Formula | C22H24FN5O5 |
| Molecular Weight | 457.46 g/mol |
| Exact Mass | 457.18 |
| IUPAC Name | N-[6-(2,6-dimethylmorpholin-4-yl)-3-pyridinyl]-1-(4-fluoro-3-nitrophenyl)-5-oxopyrrolidine-3-carboxamide |
| SMILES | CC1CN(c2ccc(NC(=O)C3CC(=O)N(c4ccc(F)c([N+](=O)[O-])c4)C3)cn2)CC(C)O1 |
| InChI | InChI=1S/C22H24FN5O5/c1-13-10-26(11-14(2)33-13)20-6-3-16(9-24-20)25-22(30)15-7-21(29)27(12-15)17-4-5-18(23)19(8-17)28(31)32/h3-6,8-9,13-15H,7,10-12H2,1-2H3,(H,25,30) |
| InChIKey | JQHCSHVHRQUIIZ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 117.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.46 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|