C22H20FN5O4 — CID 55670106
N-[2-(3,5-dimethylpyrazol-1-yl)phenyl]-1-(4-fluoro-3-nitrophenyl)-5-oxopyrrolidine-3-carboxamide (PubChem CID 55670106) has the molecular formula C22H20FN5O4 and a molecular weight of 437.43 g/mol. Its IUPAC name is N-[2-(3,5-dimethylpyrazol-1-yl)phenyl]-1-(4-fluoro-3-nitrophenyl)-5-oxopyrrolidine-3-carboxamide.
| Compound Name | N-[2-(3,5-dimethylpyrazol-1-yl)phenyl]-1-(4-fluoro-3-nitrophenyl)-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 55670106 |
| Molecular Formula | C22H20FN5O4 |
| Molecular Weight | 437.43 g/mol |
| Exact Mass | 437.15 |
| IUPAC Name | N-[2-(3,5-dimethylpyrazol-1-yl)phenyl]-1-(4-fluoro-3-nitrophenyl)-5-oxopyrrolidine-3-carboxamide |
| SMILES | Cc1cc(C)n(-c2ccccc2NC(=O)C2CC(=O)N(c3ccc(F)c([N+](=O)[O-])c3)C2)n1 |
| InChI | InChI=1S/C22H20FN5O4/c1-13-9-14(2)27(25-13)19-6-4-3-5-18(19)24-22(30)15-10-21(29)26(12-15)16-7-8-17(23)20(11-16)28(31)32/h3-9,11,15H,10,12H2,1-2H3,(H,24,30) |
| InChIKey | VTKGULKQSLXNAA-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 110.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.43 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|