C22H19N3O4 — CID 9056660
(3R)-1-(4-methyl-3-nitrophenyl)-N-naphthalen-1-yl-5-oxopyrrolidine-3-carboxamide (PubChem CID 9056660) has the molecular formula C22H19N3O4 and a molecular weight of 389.41 g/mol. Its IUPAC name is (3R)-1-(4-methyl-3-nitrophenyl)-N-naphthalen-1-yl-5-oxopyrrolidine-3-carboxamide.
| Compound Name | (3R)-1-(4-methyl-3-nitrophenyl)-N-naphthalen-1-yl-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 9056660 |
| Molecular Formula | C22H19N3O4 |
| Molecular Weight | 389.41 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | (3R)-1-(4-methyl-3-nitrophenyl)-N-naphthalen-1-yl-5-oxopyrrolidine-3-carboxamide |
| SMILES | Cc1ccc(N2C[C@H](C(=O)Nc3cccc4ccccc34)CC2=O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H19N3O4/c1-14-9-10-17(12-20(14)25(28)29)24-13-16(11-21(24)26)22(27)23-19-8-4-6-15-5-2-3-7-18(15)19/h2-10,12,16H,11,13H2,1H3,(H,23,27)/t16-/m1/s1 |
| InChIKey | QZHWIKVSKAFDER-MRXNPFEDSA-N |
| XLogP | 4.05 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.41 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|