C18H16BrN3O4 — CID 46586995
1-(3-bromophenyl)-N-(4-methyl-3-nitrophenyl)-5-oxopyrrolidine-3-carboxamide (PubChem CID 46586995) has the molecular formula C18H16BrN3O4 and a molecular weight of 418.25 g/mol. Its IUPAC name is 1-(3-bromophenyl)-N-(4-methyl-3-nitrophenyl)-5-oxopyrrolidine-3-carboxamide.
| Compound Name | 1-(3-bromophenyl)-N-(4-methyl-3-nitrophenyl)-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 46586995 |
| Molecular Formula | C18H16BrN3O4 |
| Molecular Weight | 418.25 g/mol |
| Exact Mass | 417.03 |
| IUPAC Name | 1-(3-bromophenyl)-N-(4-methyl-3-nitrophenyl)-5-oxopyrrolidine-3-carboxamide |
| SMILES | Cc1ccc(NC(=O)C2CC(=O)N(c3cccc(Br)c3)C2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H16BrN3O4/c1-11-5-6-14(9-16(11)22(25)26)20-18(24)12-7-17(23)21(10-12)15-4-2-3-13(19)8-15/h2-6,8-9,12H,7,10H2,1H3,(H,20,24) |
| InChIKey | DZBJJPIQEGMJQM-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.25 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|