C21H20FN3O4 — CID 46538960
1-(4-fluoro-3-nitrophenyl)-5-oxo-N-(5,6,7,8-tetrahydronaphthalen-1-yl)pyrrolidine-3-carboxamide (PubChem CID 46538960) has the molecular formula C21H20FN3O4 and a molecular weight of 397.41 g/mol. Its IUPAC name is 1-(4-fluoro-3-nitrophenyl)-5-oxo-N-(5,6,7,8-tetrahydronaphthalen-1-yl)pyrrolidine-3-carboxamide.
| Compound Name | 1-(4-fluoro-3-nitrophenyl)-5-oxo-N-(5,6,7,8-tetrahydronaphthalen-1-yl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 46538960 |
| Molecular Formula | C21H20FN3O4 |
| Molecular Weight | 397.41 g/mol |
| Exact Mass | 397.14 |
| IUPAC Name | 1-(4-fluoro-3-nitrophenyl)-5-oxo-N-(5,6,7,8-tetrahydronaphthalen-1-yl)pyrrolidine-3-carboxamide |
| SMILES | O=C(Nc1cccc2c1CCCC2)C1CC(=O)N(c2ccc(F)c([N+](=O)[O-])c2)C1 |
| InChI | InChI=1S/C21H20FN3O4/c22-17-9-8-15(11-19(17)25(28)29)24-12-14(10-20(24)26)21(27)23-18-7-3-5-13-4-1-2-6-16(13)18/h3,5,7-9,11,14H,1-2,4,6,10,12H2,(H,23,27) |
| InChIKey | YVXPKQHHPSVUMS-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.41 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|