C26H23FN4O5 — CID 25496965
(3S)-1-(4-fluoro-3-nitrophenyl)-5-oxo-N-[2-[[(1R)-1-phenylethyl]carbamoyl]phenyl]pyrrolidine-3-carboxamide (PubChem CID 25496965) has the molecular formula C26H23FN4O5 and a molecular weight of 490.49 g/mol. Its IUPAC name is (3S)-1-(4-fluoro-3-nitrophenyl)-5-oxo-N-[2-[[(1R)-1-phenylethyl]carbamoyl]phenyl]pyrrolidine-3-carboxamide.
| Compound Name | (3S)-1-(4-fluoro-3-nitrophenyl)-5-oxo-N-[2-[[(1R)-1-phenylethyl]carbamoyl]phenyl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 25496965 |
| Molecular Formula | C26H23FN4O5 |
| Molecular Weight | 490.49 g/mol |
| Exact Mass | 490.17 |
| IUPAC Name | (3S)-1-(4-fluoro-3-nitrophenyl)-5-oxo-N-[2-[[(1R)-1-phenylethyl]carbamoyl]phenyl]pyrrolidine-3-carboxamide |
| SMILES | C[C@@H](NC(=O)c1ccccc1NC(=O)[C@H]1CC(=O)N(c2ccc(F)c([N+](=O)[O-])c2)C1)c1ccccc1 |
| InChI | InChI=1S/C26H23FN4O5/c1-16(17-7-3-2-4-8-17)28-26(34)20-9-5-6-10-22(20)29-25(33)18-13-24(32)30(15-18)19-11-12-21(27)23(14-19)31(35)36/h2-12,14,16,18H,13,15H2,1H3,(H,28,34)(H,29,33)/t16-,18+/m1/s1 |
| InChIKey | UNFXUWYJZAFODX-AEFFLSMTSA-N |
| XLogP | 4.22 |
| TPSA | 121.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.49 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|