C13H11F4N3O4 — CID 166194357
1-(4-fluoro-3-nitrophenyl)-5-oxo-N-(2,2,2-trifluoroethyl)pyrrolidine-3-carboxamide (PubChem CID 166194357) has the molecular formula C13H11F4N3O4 and a molecular weight of 349.24 g/mol. Its IUPAC name is 1-(4-fluoro-3-nitrophenyl)-5-oxo-N-(2,2,2-trifluoroethyl)pyrrolidine-3-carboxamide.
| Compound Name | 1-(4-fluoro-3-nitrophenyl)-5-oxo-N-(2,2,2-trifluoroethyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 166194357 |
| Molecular Formula | C13H11F4N3O4 |
| Molecular Weight | 349.24 g/mol |
| Exact Mass | 349.07 |
| IUPAC Name | 1-(4-fluoro-3-nitrophenyl)-5-oxo-N-(2,2,2-trifluoroethyl)pyrrolidine-3-carboxamide |
| SMILES | O=C(NCC(F)(F)F)C1CC(=O)N(c2ccc(F)c([N+](=O)[O-])c2)C1 |
| InChI | InChI=1S/C13H11F4N3O4/c14-9-2-1-8(4-10(9)20(23)24)19-5-7(3-11(19)21)12(22)18-6-13(15,16)17/h1-2,4,7H,3,5-6H2,(H,18,22) |
| InChIKey | SVLLKIWMYATEKO-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.24 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|