C23H26FN3O6 — CID 55537297
N-[2-(3,4-diethoxyphenyl)ethyl]-1-(4-fluoro-3-nitrophenyl)-5-oxopyrrolidine-3-carboxamide (PubChem CID 55537297) has the molecular formula C23H26FN3O6 and a molecular weight of 459.47 g/mol. Its IUPAC name is N-[2-(3,4-diethoxyphenyl)ethyl]-1-(4-fluoro-3-nitrophenyl)-5-oxopyrrolidine-3-carboxamide.
| Compound Name | N-[2-(3,4-diethoxyphenyl)ethyl]-1-(4-fluoro-3-nitrophenyl)-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 55537297 |
| Molecular Formula | C23H26FN3O6 |
| Molecular Weight | 459.47 g/mol |
| Exact Mass | 459.18 |
| IUPAC Name | N-[2-(3,4-diethoxyphenyl)ethyl]-1-(4-fluoro-3-nitrophenyl)-5-oxopyrrolidine-3-carboxamide |
| SMILES | CCOc1ccc(CCNC(=O)C2CC(=O)N(c3ccc(F)c([N+](=O)[O-])c3)C2)cc1OCC |
| InChI | InChI=1S/C23H26FN3O6/c1-3-32-20-8-5-15(11-21(20)33-4-2)9-10-25-23(29)16-12-22(28)26(14-16)17-6-7-18(24)19(13-17)27(30)31/h5-8,11,13,16H,3-4,9-10,12,14H2,1-2H3,(H,25,29) |
| InChIKey | KOVCPTAAEHRUPS-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 111.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.47 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|