C14H17F4N3O2 — CID 119514748
N-(pyrrolidin-2-ylmethyl)-6-(2,2,3,3-tetrafluoropropoxy)pyridine-3-carboxamide (PubChem CID 119514748) has the molecular formula C14H17F4N3O2 and a molecular weight of 335.30 g/mol. Its IUPAC name is N-(pyrrolidin-2-ylmethyl)-6-(2,2,3,3-tetrafluoropropoxy)pyridine-3-carboxamide.
| Compound Name | N-(pyrrolidin-2-ylmethyl)-6-(2,2,3,3-tetrafluoropropoxy)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 119514748 |
| Molecular Formula | C14H17F4N3O2 |
| Molecular Weight | 335.30 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | N-(pyrrolidin-2-ylmethyl)-6-(2,2,3,3-tetrafluoropropoxy)pyridine-3-carboxamide |
| SMILES | O=C(NCC1CCCN1)c1ccc(OCC(F)(F)C(F)F)nc1 |
| InChI | InChI=1S/C14H17F4N3O2/c15-13(16)14(17,18)8-23-11-4-3-9(6-20-11)12(22)21-7-10-2-1-5-19-10/h3-4,6,10,13,19H,1-2,5,7-8H2,(H,21,22) |
| InChIKey | ULJNAPFFECOIHG-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.30 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|