C15H21F4N3O2 — CID 119572061
N-[3-(aminomethyl)pentan-3-yl]-6-(2,2,3,3-tetrafluoropropoxy)pyridine-3-carboxamide (PubChem CID 119572061) has the molecular formula C15H21F4N3O2 and a molecular weight of 351.34 g/mol. Its IUPAC name is N-[3-(aminomethyl)pentan-3-yl]-6-(2,2,3,3-tetrafluoropropoxy)pyridine-3-carboxamide.
| Compound Name | N-[3-(aminomethyl)pentan-3-yl]-6-(2,2,3,3-tetrafluoropropoxy)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 119572061 |
| Molecular Formula | C15H21F4N3O2 |
| Molecular Weight | 351.34 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | N-[3-(aminomethyl)pentan-3-yl]-6-(2,2,3,3-tetrafluoropropoxy)pyridine-3-carboxamide |
| SMILES | CCC(CC)(CN)NC(=O)c1ccc(OCC(F)(F)C(F)F)nc1 |
| InChI | InChI=1S/C15H21F4N3O2/c1-3-14(4-2,8-20)22-12(23)10-5-6-11(21-7-10)24-9-15(18,19)13(16)17/h5-7,13H,3-4,8-9,20H2,1-2H3,(H,22,23) |
| InChIKey | UESRQAJFVUOTCI-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.34 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|