C15H16F4N2O4 — CID 119350550
1-[[6-(2,2,3,3-tetrafluoropropoxy)pyridine-3-carbonyl]amino]cyclopentane-1-carboxylic acid (PubChem CID 119350550) has the molecular formula C15H16F4N2O4 and a molecular weight of 364.30 g/mol. Its IUPAC name is 1-[[6-(2,2,3,3-tetrafluoropropoxy)pyridine-3-carbonyl]amino]cyclopentane-1-carboxylic acid.
| Compound Name | 1-[[6-(2,2,3,3-tetrafluoropropoxy)pyridine-3-carbonyl]amino]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 119350550 |
| Molecular Formula | C15H16F4N2O4 |
| Molecular Weight | 364.30 g/mol |
| Exact Mass | 364.10 |
| IUPAC Name | 1-[[6-(2,2,3,3-tetrafluoropropoxy)pyridine-3-carbonyl]amino]cyclopentane-1-carboxylic acid |
| SMILES | O=C(NC1(C(=O)O)CCCC1)c1ccc(OCC(F)(F)C(F)F)nc1 |
| InChI | InChI=1S/C15H16F4N2O4/c16-12(17)15(18,19)8-25-10-4-3-9(7-20-10)11(22)21-14(13(23)24)5-1-2-6-14/h3-4,7,12H,1-2,5-6,8H2,(H,21,22)(H,23,24) |
| InChIKey | CJKBCIPYZFXHPY-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.30 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|