C13H18ClF4N3O2 — CID 119525133
N-(1-amino-2-methylpropan-2-yl)-6-(2,2,3,3-tetrafluoropropoxy)pyridine-3-carboxamide;hydrochloride (PubChem CID 119525133) has the molecular formula C13H18ClF4N3O2 and a molecular weight of 359.75 g/mol. Its IUPAC name is N-(1-amino-2-methylpropan-2-yl)-6-(2,2,3,3-tetrafluoropropoxy)pyridine-3-carboxamide;hydrochloride.
| Compound Name | N-(1-amino-2-methylpropan-2-yl)-6-(2,2,3,3-tetrafluoropropoxy)pyridine-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119525133 |
| Molecular Formula | C13H18ClF4N3O2 |
| Molecular Weight | 359.75 g/mol |
| Exact Mass | 359.10 |
| IUPAC Name | N-(1-amino-2-methylpropan-2-yl)-6-(2,2,3,3-tetrafluoropropoxy)pyridine-3-carboxamide;hydrochloride |
| SMILES | CC(C)(CN)NC(=O)c1ccc(OCC(F)(F)C(F)F)nc1.Cl |
| InChI | InChI=1S/C13H17F4N3O2.ClH/c1-12(2,6-18)20-10(21)8-3-4-9(19-5-8)22-7-13(16,17)11(14)15;/h3-5,11H,6-7,18H2,1-2H3,(H,20,21);1H |
| InChIKey | UCPHICUUKZCQBT-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.75 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|