C13H16F2N2OS — CID 119512475
4-(difluoromethylsulfanyl)-N-(pyrrolidin-2-ylmethyl)benzamide (PubChem CID 119512475) has the molecular formula C13H16F2N2OS and a molecular weight of 286.35 g/mol. Its IUPAC name is 4-(difluoromethylsulfanyl)-N-(pyrrolidin-2-ylmethyl)benzamide.
| Compound Name | 4-(difluoromethylsulfanyl)-N-(pyrrolidin-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 119512475 |
| Molecular Formula | C13H16F2N2OS |
| Molecular Weight | 286.35 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | 4-(difluoromethylsulfanyl)-N-(pyrrolidin-2-ylmethyl)benzamide |
| SMILES | O=C(NCC1CCCN1)c1ccc(SC(F)F)cc1 |
| InChI | InChI=1S/C13H16F2N2OS/c14-13(15)19-11-5-3-9(4-6-11)12(18)17-8-10-2-1-7-16-10/h3-6,10,13,16H,1-2,7-8H2,(H,17,18) |
| InChIKey | FWPIDODNMKPXOE-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.35 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |