C13H16F2N2O2S — CID 120947897
4-(difluoromethylsulfanyl)-N-[(4-hydroxypyrrolidin-3-yl)methyl]benzamide (PubChem CID 120947897) has the molecular formula C13H16F2N2O2S and a molecular weight of 302.35 g/mol. Its IUPAC name is 4-(difluoromethylsulfanyl)-N-[(4-hydroxypyrrolidin-3-yl)methyl]benzamide.
| Compound Name | 4-(difluoromethylsulfanyl)-N-[(4-hydroxypyrrolidin-3-yl)methyl]benzamide |
|---|---|
| PubChem CID | 120947897 |
| Molecular Formula | C13H16F2N2O2S |
| Molecular Weight | 302.35 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | 4-(difluoromethylsulfanyl)-N-[(4-hydroxypyrrolidin-3-yl)methyl]benzamide |
| SMILES | O=C(NCC1CNCC1O)c1ccc(SC(F)F)cc1 |
| InChI | InChI=1S/C13H16F2N2O2S/c14-13(15)20-10-3-1-8(2-4-10)12(19)17-6-9-5-16-7-11(9)18/h1-4,9,11,13,16,18H,5-7H2,(H,17,19) |
| InChIKey | VRTODCFKNVBTEO-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.35 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |