C12H14F4N4O3 — CID 95322424
(2R)-N-carbamoyl-2-[[6-(2,2,3,3-tetrafluoropropoxy)-3-pyridinyl]amino]propanamide (PubChem CID 95322424) has the molecular formula C12H14F4N4O3 and a molecular weight of 338.26 g/mol. Its IUPAC name is (2R)-N-carbamoyl-2-[[6-(2,2,3,3-tetrafluoropropoxy)-3-pyridinyl]amino]propanamide.
| Compound Name | (2R)-N-carbamoyl-2-[[6-(2,2,3,3-tetrafluoropropoxy)-3-pyridinyl]amino]propanamide |
|---|---|
| PubChem CID | 95322424 |
| Molecular Formula | C12H14F4N4O3 |
| Molecular Weight | 338.26 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | (2R)-N-carbamoyl-2-[[6-(2,2,3,3-tetrafluoropropoxy)-3-pyridinyl]amino]propanamide |
| SMILES | C[C@@H](Nc1ccc(OCC(F)(F)C(F)F)nc1)C(=O)NC(N)=O |
| InChI | InChI=1S/C12H14F4N4O3/c1-6(9(21)20-11(17)22)19-7-2-3-8(18-4-7)23-5-12(15,16)10(13)14/h2-4,6,10,19H,5H2,1H3,(H3,17,20,21,22)/t6-/m1/s1 |
| InChIKey | HWLIIDIYTYPIFU-ZCFIWIBFSA-N |
| XLogP | 1.36 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.26 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|