C17H17F4N3O2 — CID 120670168
2-amino-2-(4-methylphenyl)-N-[6-(2,2,3,3-tetrafluoropropoxy)-3-pyridinyl]acetamide (PubChem CID 120670168) has the molecular formula C17H17F4N3O2 and a molecular weight of 371.33 g/mol. Its IUPAC name is 2-amino-2-(4-methylphenyl)-N-[6-(2,2,3,3-tetrafluoropropoxy)-3-pyridinyl]acetamide.
| Compound Name | 2-amino-2-(4-methylphenyl)-N-[6-(2,2,3,3-tetrafluoropropoxy)-3-pyridinyl]acetamide |
|---|---|
| PubChem CID | 120670168 |
| Molecular Formula | C17H17F4N3O2 |
| Molecular Weight | 371.33 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | 2-amino-2-(4-methylphenyl)-N-[6-(2,2,3,3-tetrafluoropropoxy)-3-pyridinyl]acetamide |
| SMILES | Cc1ccc(C(N)C(=O)Nc2ccc(OCC(F)(F)C(F)F)nc2)cc1 |
| InChI | InChI=1S/C17H17F4N3O2/c1-10-2-4-11(5-3-10)14(22)15(25)24-12-6-7-13(23-8-12)26-9-17(20,21)16(18)19/h2-8,14,16H,9,22H2,1H3,(H,24,25) |
| InChIKey | HAXTUNNSAPLXSZ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.33 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|