C10H11F3N2O3 — CID 61067882
ethyl N-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]carbamate (PubChem CID 61067882) has the molecular formula C10H11F3N2O3 and a molecular weight of 264.20 g/mol. Its IUPAC name is ethyl N-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]carbamate.
| Compound Name | ethyl N-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]carbamate |
|---|---|
| PubChem CID | 61067882 |
| Molecular Formula | C10H11F3N2O3 |
| Molecular Weight | 264.20 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | ethyl N-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]carbamate |
| SMILES | CCOC(=O)Nc1ccc(OCC(F)(F)F)nc1 |
| InChI | InChI=1S/C10H11F3N2O3/c1-2-17-9(16)15-7-3-4-8(14-5-7)18-6-10(11,12)13/h3-5H,2,6H2,1H3,(H,15,16) |
| InChIKey | LMTKXEBQTBHUEZ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.20 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |