C13H18F3N3O2 — CID 43700692
6-amino-N-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]hexanamide (PubChem CID 43700692) has the molecular formula C13H18F3N3O2 and a molecular weight of 305.30 g/mol. Its IUPAC name is 6-amino-N-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]hexanamide.
| Compound Name | 6-amino-N-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]hexanamide |
|---|---|
| PubChem CID | 43700692 |
| Molecular Formula | C13H18F3N3O2 |
| Molecular Weight | 305.30 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | 6-amino-N-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]hexanamide |
| SMILES | NCCCCCC(=O)Nc1ccc(OCC(F)(F)F)nc1 |
| InChI | InChI=1S/C13H18F3N3O2/c14-13(15,16)9-21-12-6-5-10(8-18-12)19-11(20)4-2-1-3-7-17/h5-6,8H,1-4,7,9,17H2,(H,19,20) |
| InChIKey | WSZLBJLAOWKQFB-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.30 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|