C16H23ClF3N3O2 — CID 119726154
4-(7-aminoheptanoylamino)-N-(2,2,2-trifluoroethyl)benzamide;hydrochloride (PubChem CID 119726154) has the molecular formula C16H23ClF3N3O2 and a molecular weight of 381.83 g/mol. Its IUPAC name is 4-(7-aminoheptanoylamino)-N-(2,2,2-trifluoroethyl)benzamide;hydrochloride.
| Compound Name | 4-(7-aminoheptanoylamino)-N-(2,2,2-trifluoroethyl)benzamide;hydrochloride |
|---|---|
| PubChem CID | 119726154 |
| Molecular Formula | C16H23ClF3N3O2 |
| Molecular Weight | 381.83 g/mol |
| Exact Mass | 381.14 |
| IUPAC Name | 4-(7-aminoheptanoylamino)-N-(2,2,2-trifluoroethyl)benzamide;hydrochloride |
| SMILES | Cl.NCCCCCCC(=O)Nc1ccc(C(=O)NCC(F)(F)F)cc1 |
| InChI | InChI=1S/C16H22F3N3O2.ClH/c17-16(18,19)11-21-15(24)12-6-8-13(9-7-12)22-14(23)5-3-1-2-4-10-20;/h6-9H,1-5,10-11,20H2,(H,21,24)(H,22,23);1H |
| InChIKey | CBDGOSVEPZDKDA-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.83 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|