C15H21N3O4 — CID 119277505
methyl 3-[[4-(4-aminobutanoylamino)benzoyl]amino]propanoate (PubChem CID 119277505) has the molecular formula C15H21N3O4 and a molecular weight of 307.35 g/mol. Its IUPAC name is methyl 3-[[4-(4-aminobutanoylamino)benzoyl]amino]propanoate.
| Compound Name | methyl 3-[[4-(4-aminobutanoylamino)benzoyl]amino]propanoate |
|---|---|
| PubChem CID | 119277505 |
| Molecular Formula | C15H21N3O4 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.15 |
| IUPAC Name | methyl 3-[[4-(4-aminobutanoylamino)benzoyl]amino]propanoate |
| SMILES | COC(=O)CCNC(=O)c1ccc(NC(=O)CCCN)cc1 |
| InChI | InChI=1S/C15H21N3O4/c1-22-14(20)8-10-17-15(21)11-4-6-12(7-5-11)18-13(19)3-2-9-16/h4-7H,2-3,8-10,16H2,1H3,(H,17,21)(H,18,19) |
| InChIKey | GVNPONGVAIDXTE-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |