C16H23N3O5 — CID 120587768
methyl 3-[[4-[(4-amino-3-methoxybutanoyl)amino]benzoyl]amino]propanoate (PubChem CID 120587768) has the molecular formula C16H23N3O5 and a molecular weight of 337.38 g/mol. Its IUPAC name is methyl 3-[[4-[(4-amino-3-methoxybutanoyl)amino]benzoyl]amino]propanoate.
| Compound Name | methyl 3-[[4-[(4-amino-3-methoxybutanoyl)amino]benzoyl]amino]propanoate |
|---|---|
| PubChem CID | 120587768 |
| Molecular Formula | C16H23N3O5 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.16 |
| IUPAC Name | methyl 3-[[4-[(4-amino-3-methoxybutanoyl)amino]benzoyl]amino]propanoate |
| SMILES | COC(=O)CCNC(=O)c1ccc(NC(=O)CC(CN)OC)cc1 |
| InChI | InChI=1S/C16H23N3O5/c1-23-13(10-17)9-14(20)19-12-5-3-11(4-6-12)16(22)18-8-7-15(21)24-2/h3-6,13H,7-10,17H2,1-2H3,(H,18,22)(H,19,20) |
| InChIKey | FMNFSYZAJACKHU-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 119.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |