C18H23F3N2O2 — CID 46803503
4-(3-cyclohexylpropanoylamino)-N-(2,2,2-trifluoroethyl)benzamide (PubChem CID 46803503) has the molecular formula C18H23F3N2O2 and a molecular weight of 356.39 g/mol. Its IUPAC name is 4-(3-cyclohexylpropanoylamino)-N-(2,2,2-trifluoroethyl)benzamide.
| Compound Name | 4-(3-cyclohexylpropanoylamino)-N-(2,2,2-trifluoroethyl)benzamide |
|---|---|
| PubChem CID | 46803503 |
| Molecular Formula | C18H23F3N2O2 |
| Molecular Weight | 356.39 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | 4-(3-cyclohexylpropanoylamino)-N-(2,2,2-trifluoroethyl)benzamide |
| SMILES | O=C(CCC1CCCCC1)Nc1ccc(C(=O)NCC(F)(F)F)cc1 |
| InChI | InChI=1S/C18H23F3N2O2/c19-18(20,21)12-22-17(25)14-7-9-15(10-8-14)23-16(24)11-6-13-4-2-1-3-5-13/h7-10,13H,1-6,11-12H2,(H,22,25)(H,23,24) |
| InChIKey | DYHXSTUSGBRJGZ-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.39 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |