C23H33N3O4 — CID 121062677
N-[2-[[4-(3-cyclohexylpropanoylamino)benzoyl]amino]ethyl]oxolane-2-carboxamide (PubChem CID 121062677) has the molecular formula C23H33N3O4 and a molecular weight of 415.53 g/mol. Its IUPAC name is N-[2-[[4-(3-cyclohexylpropanoylamino)benzoyl]amino]ethyl]oxolane-2-carboxamide.
| Compound Name | N-[2-[[4-(3-cyclohexylpropanoylamino)benzoyl]amino]ethyl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 121062677 |
| Molecular Formula | C23H33N3O4 |
| Molecular Weight | 415.53 g/mol |
| Exact Mass | 415.25 |
| IUPAC Name | N-[2-[[4-(3-cyclohexylpropanoylamino)benzoyl]amino]ethyl]oxolane-2-carboxamide |
| SMILES | O=C(CCC1CCCCC1)Nc1ccc(C(=O)NCCNC(=O)C2CCCO2)cc1 |
| InChI | InChI=1S/C23H33N3O4/c27-21(13-8-17-5-2-1-3-6-17)26-19-11-9-18(10-12-19)22(28)24-14-15-25-23(29)20-7-4-16-30-20/h9-12,17,20H,1-8,13-16H2,(H,24,28)(H,25,29)(H,26,27) |
| InChIKey | SOBHAKCXRKOEAG-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.53 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|