C28H27N3O5 — CID 121062639
N-[2-[[4-[(2-benzoylbenzoyl)amino]benzoyl]amino]ethyl]oxolane-2-carboxamide (PubChem CID 121062639) has the molecular formula C28H27N3O5 and a molecular weight of 485.54 g/mol. Its IUPAC name is N-[2-[[4-[(2-benzoylbenzoyl)amino]benzoyl]amino]ethyl]oxolane-2-carboxamide.
| Compound Name | N-[2-[[4-[(2-benzoylbenzoyl)amino]benzoyl]amino]ethyl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 121062639 |
| Molecular Formula | C28H27N3O5 |
| Molecular Weight | 485.54 g/mol |
| Exact Mass | 485.20 |
| IUPAC Name | N-[2-[[4-[(2-benzoylbenzoyl)amino]benzoyl]amino]ethyl]oxolane-2-carboxamide |
| SMILES | O=C(NCCNC(=O)C1CCCO1)c1ccc(NC(=O)c2ccccc2C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C28H27N3O5/c32-25(19-7-2-1-3-8-19)22-9-4-5-10-23(22)27(34)31-21-14-12-20(13-15-21)26(33)29-16-17-30-28(35)24-11-6-18-36-24/h1-5,7-10,12-15,24H,6,11,16-18H2,(H,29,33)(H,30,35)(H,31,34) |
| InChIKey | MTMCGRWUIPNXRP-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.54 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|